C19H22FNO3 — CID 110441404
N-[2-(2-fluorophenyl)-2-methylpropyl]-3,4-dimethoxybenzamide (PubChem CID 110441404) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methylpropyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methylpropyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 110441404 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methylpropyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(C)(C)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C19H22FNO3/c1-19(2,14-7-5-6-8-15(14)20)12-21-18(22)13-9-10-16(23-3)17(11-13)24-4/h5-11H,12H2,1-4H3,(H,21,22) |
| InChIKey | VJCLYHJLCGZVSD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |