About 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide
3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide (PubChem CID 110442437) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide |
| PubChem CID | 110442437 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide |
| SMILES | Cc1cc(C)c2c(NC(=O)CCN(C)C)csc2n1 |
| InChI | InChI=1S/C14H19N3OS/c1-9-7-10(2)15-14-13(9)11(8-19-14)16-12(18)5-6-17(3)4/h7-8H,5-6H2,1-4H3,(H,16,18) |
| InChIKey | PZWVLDPGAPSXOM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide?
The IUPAC name of 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide (CID 110442437) is 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide.
What is the SMILES notation for 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide?
The canonical SMILES for 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide is Cc1cc(C)c2c(NC(=O)CCN(C)C)csc2n1.
What is the InChIKey of 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide?
The InChIKey is PZWVLDPGAPSXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c1-9-7-10(2)15-14-13(9)11(8-19-14)16-12(18)5-6-17(3)4/h7-8H,5-6H2,1-4H3,(H,16,18).
What are the key properties of 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide?
3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide has a molecular weight of 277.39 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)propanamide is sourced from PubChem (CID 110442437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).