C18H18N2O3S — CID 110443954
N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)-2,6-dimethoxybenzamide (PubChem CID 110443954) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)-2,6-dimethoxybenzamide.
| Compound Name | N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 110443954 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(4,6-dimethylthieno[2,3-b]pyridin-3-yl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1csc2nc(C)cc(C)c12 |
| InChI | InChI=1S/C18H18N2O3S/c1-10-8-11(2)19-18-15(10)12(9-24-18)20-17(21)16-13(22-3)6-5-7-14(16)23-4/h5-9H,1-4H3,(H,20,21) |
| InChIKey | OEZXEQPPKBMQTB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |