C17H14Cl2FNO — CID 110443081
2,4-dichloro-N-[1-(4-fluorophenyl)cyclobutyl]benzamide (PubChem CID 110443081) has the molecular formula C17H14Cl2FNO and a molecular weight of 338.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(4-fluorophenyl)cyclobutyl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(4-fluorophenyl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 110443081 |
| Molecular Formula | C17H14Cl2FNO |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2,4-dichloro-N-[1-(4-fluorophenyl)cyclobutyl]benzamide |
| SMILES | O=C(NC1(c2ccc(F)cc2)CCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2FNO/c18-12-4-7-14(15(19)10-12)16(22)21-17(8-1-9-17)11-2-5-13(20)6-3-11/h2-7,10H,1,8-9H2,(H,21,22) |
| InChIKey | CTVUVBXHPWXSNJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |