C18H25NO2 — CID 11044401
(4S,5S)-3-benzyl-4-[(E)-3-methylbut-1-enyl]-5-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 11044401) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (4S,5S)-3-benzyl-4-[(E)-3-methylbut-1-enyl]-5-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-benzyl-4-[(E)-3-methylbut-1-enyl]-5-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11044401 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (4S,5S)-3-benzyl-4-[(E)-3-methylbut-1-enyl]-5-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)/C=C/[C@H]1[C@H](C(C)C)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-13(2)10-11-16-17(14(3)4)21-18(20)19(16)12-15-8-6-5-7-9-15/h5-11,13-14,16-17H,12H2,1-4H3/b11-10+/t16-,17-/m0/s1 |
| InChIKey | JMRGYQAOLVVCOD-YOIRJEGESA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|