C14H16N4O2S — CID 110444257
2-morpholin-4-yl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 110444257) has the molecular formula C14H16N4O2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-morpholin-4-yl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 110444257 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-morpholin-4-yl-N-(4-pyridin-4-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCOCC1)Nc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C14H16N4O2S/c19-13(9-18-5-7-20-8-6-18)17-14-16-12(10-21-14)11-1-3-15-4-2-11/h1-4,10H,5-9H2,(H,16,17,19) |
| InChIKey | KBHXEOVXZUYXSN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |