C23H25N5O3S — CID 161042994
N-[3-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 161042994) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is N-[3-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[3-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 161042994 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[3-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1cccc(-c2csc(NC(=O)NCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H25N5O3S/c29-21(15-28-9-11-31-12-10-28)25-19-8-4-7-18(13-19)20-16-32-23(26-20)27-22(30)24-14-17-5-2-1-3-6-17/h1-8,13,16H,9-12,14-15H2,(H,25,29)(H2,24,26,27,30) |
| InChIKey | UBCVLOMXFWJRNZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |