C17H21N3O2S — CID 110447235
methyl (E)-3-[4-[2-(dimethylamino)phenyl]-2-(methylamino)-1,3-thiazol-5-yl]but-2-enoate (PubChem CID 110447235) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-(dimethylamino)phenyl]-2-(methylamino)-1,3-thiazol-5-yl]but-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-(dimethylamino)phenyl]-2-(methylamino)-1,3-thiazol-5-yl]but-2-enoate |
|---|---|
| PubChem CID | 110447235 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl (E)-3-[4-[2-(dimethylamino)phenyl]-2-(methylamino)-1,3-thiazol-5-yl]but-2-enoate |
| SMILES | CNc1nc(-c2ccccc2N(C)C)c(/C(C)=C/C(=O)OC)s1 |
| InChI | InChI=1S/C17H21N3O2S/c1-11(10-14(21)22-5)16-15(19-17(18-2)23-16)12-8-6-7-9-13(12)20(3)4/h6-10H,1-5H3,(H,18,19)/b11-10+ |
| InChIKey | IRLONIYYSUTQHW-ZHACJKMWSA-N |
| XLogP | 3.49 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|