C17H11ClN2O3 — CID 110448339
4-[(6-chloro-1-cyano-3-oxo-1H-isoindol-2-yl)methyl]benzoic acid (PubChem CID 110448339) has the molecular formula C17H11ClN2O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is 4-[(6-chloro-1-cyano-3-oxo-1H-isoindol-2-yl)methyl]benzoic acid.
| Compound Name | 4-[(6-chloro-1-cyano-3-oxo-1H-isoindol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 110448339 |
| Molecular Formula | C17H11ClN2O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-[(6-chloro-1-cyano-3-oxo-1H-isoindol-2-yl)methyl]benzoic acid |
| SMILES | N#CC1c2cc(Cl)ccc2C(=O)N1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H11ClN2O3/c18-12-5-6-13-14(7-12)15(8-19)20(16(13)21)9-10-1-3-11(4-2-10)17(22)23/h1-7,15H,9H2,(H,22,23) |
| InChIKey | FIXGESYXQQVPLJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |