C16H20N4O2S — CID 110451761
2-(4-aminophenyl)-2-methyl-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 110451761) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-2-methyl-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-(4-aminophenyl)-2-methyl-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 110451761 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(4-aminophenyl)-2-methyl-N-[5-(oxolan-2-yl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)(C(=O)Nc1nnc(C2CCCO2)s1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H20N4O2S/c1-16(2,10-5-7-11(17)8-6-10)14(21)18-15-20-19-13(23-15)12-4-3-9-22-12/h5-8,12H,3-4,9,17H2,1-2H3,(H,18,20,21) |
| InChIKey | LHIFNZJIZVRFIU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|