C20H20FN3 — CID 110452390
1-N-[(4-fluorophenyl)-pyridin-4-ylmethyl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 110452390) has the molecular formula C20H20FN3 and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-N-[(4-fluorophenyl)-pyridin-4-ylmethyl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(4-fluorophenyl)-pyridin-4-ylmethyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 110452390 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-N-[(4-fluorophenyl)-pyridin-4-ylmethyl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NC(c2ccncc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H20FN3/c1-24(2)19-9-7-18(8-10-19)23-20(16-11-13-22-14-12-16)15-3-5-17(21)6-4-15/h3-14,20,23H,1-2H3 |
| InChIKey | ULNAWTNIMXLWTK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|