C19H24FNO3 — CID 110452442
N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-fluoro-4-methoxyaniline (PubChem CID 110452442) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-fluoro-4-methoxyaniline.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 110452442 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-fluoro-4-methoxyaniline |
| SMILES | COc1ccc(NCC(C)(C)c2ccc(OC)c(OC)c2)cc1F |
| InChI | InChI=1S/C19H24FNO3/c1-19(2,13-6-8-17(23-4)18(10-13)24-5)12-21-14-7-9-16(22-3)15(20)11-14/h6-11,21H,12H2,1-5H3 |
| InChIKey | NNNIQQKQPSUIAE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|