C12H20FN3O — CID 115261404
2-(3-fluoro-4-methoxyphenyl)-N-(hydrazinylmethyl)-2-methylpropan-1-amine (PubChem CID 115261404) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-N-(hydrazinylmethyl)-2-methylpropan-1-amine.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-N-(hydrazinylmethyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115261404 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-N-(hydrazinylmethyl)-2-methylpropan-1-amine |
| SMILES | COc1ccc(C(C)(C)CNCNN)cc1F |
| InChI | InChI=1S/C12H20FN3O/c1-12(2,7-15-8-16-14)9-4-5-11(17-3)10(13)6-9/h4-6,15-16H,7-8,14H2,1-3H3 |
| InChIKey | HHEDJOONFWAHGE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|