C19H32Si2 — CID 11045325
trimethyl-[4-[(5E)-7-trimethylsilylhepta-1,5-dien-2-yl]phenyl]silane (PubChem CID 11045325) has the molecular formula C19H32Si2 and a molecular weight of 316.64 g/mol. Its IUPAC name is trimethyl-[4-[(5E)-7-trimethylsilylhepta-1,5-dien-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[(5E)-7-trimethylsilylhepta-1,5-dien-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 11045325 |
| Molecular Formula | C19H32Si2 |
| Molecular Weight | 316.64 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | trimethyl-[4-[(5E)-7-trimethylsilylhepta-1,5-dien-2-yl]phenyl]silane |
| SMILES | C=C(CC/C=C/C[Si](C)(C)C)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H32Si2/c1-17(11-9-8-10-16-20(2,3)4)18-12-14-19(15-13-18)21(5,6)7/h8,10,12-15H,1,9,11,16H2,2-7H3/b10-8+ |
| InChIKey | QFJZWKQDMUVYAC-CSKARUKUSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|