C20H16N4O2 — CID 110453289
4-[1H-indol-3-yl-(pyrimidin-2-ylamino)methyl]benzoic acid (PubChem CID 110453289) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[1H-indol-3-yl-(pyrimidin-2-ylamino)methyl]benzoic acid.
| Compound Name | 4-[1H-indol-3-yl-(pyrimidin-2-ylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 110453289 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[1H-indol-3-yl-(pyrimidin-2-ylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(Nc2ncccn2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H16N4O2/c25-19(26)14-8-6-13(7-9-14)18(24-20-21-10-3-11-22-20)16-12-23-17-5-2-1-4-15(16)17/h1-12,18,23H,(H,25,26)(H,21,22,24) |
| InChIKey | PJBTWLRFSFPMCS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |