C19H29NOS — CID 11045407
(4S)-2-methyl-4-octyl-4-(phenylsulfanylmethyl)-5H-1,3-oxazole (PubChem CID 11045407) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is (4S)-2-methyl-4-octyl-4-(phenylsulfanylmethyl)-5H-1,3-oxazole.
| Compound Name | (4S)-2-methyl-4-octyl-4-(phenylsulfanylmethyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11045407 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (4S)-2-methyl-4-octyl-4-(phenylsulfanylmethyl)-5H-1,3-oxazole |
| SMILES | CCCCCCCC[C@@]1(CSc2ccccc2)COC(C)=N1 |
| InChI | InChI=1S/C19H29NOS/c1-3-4-5-6-7-11-14-19(15-21-17(2)20-19)16-22-18-12-9-8-10-13-18/h8-10,12-13H,3-7,11,14-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | ZHOVCLWHKACEKC-IBGZPJMESA-N |
| XLogP | 5.72 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|