C17H19N5O2 — CID 110455570
N-[5-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-phenylacetamide (PubChem CID 110455570) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[5-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-phenylacetamide.
| Compound Name | N-[5-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 110455570 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[5-(2-methoxyethylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-phenylacetamide |
| SMILES | COCCNc1cccc2nc(NC(=O)Cc3ccccc3)nn12 |
| InChI | InChI=1S/C17H19N5O2/c1-24-11-10-18-14-8-5-9-15-19-17(21-22(14)15)20-16(23)12-13-6-3-2-4-7-13/h2-9,18H,10-12H2,1H3,(H,20,21,23) |
| InChIKey | XMUKYUUGLZFZST-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|