C18H17N5O2 — CID 110455809
N-[5-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-4-carboxamide (PubChem CID 110455809) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[5-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[5-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 110455809 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[5-(2-hydroxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1nc2n(n1)C(c1ccccc1O)CCC2)c1ccncc1 |
| InChI | InChI=1S/C18H17N5O2/c24-15-6-2-1-4-13(15)14-5-3-7-16-20-18(22-23(14)16)21-17(25)12-8-10-19-11-9-12/h1-2,4,6,8-11,14,24H,3,5,7H2,(H,21,22,25) |
| InChIKey | IPVJUSMMRPMVPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|