C15H10F3N3O2 — CID 110456393
4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazol-2-yl]methyl]phenol (PubChem CID 110456393) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazol-2-yl]methyl]phenol.
| Compound Name | 4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazol-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 110456393 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[[5-(2,3,4-trifluoroanilino)-1,3,4-oxadiazol-2-yl]methyl]phenol |
| SMILES | Oc1ccc(Cc2nnc(Nc3ccc(F)c(F)c3F)o2)cc1 |
| InChI | InChI=1S/C15H10F3N3O2/c16-10-5-6-11(14(18)13(10)17)19-15-21-20-12(23-15)7-8-1-3-9(22)4-2-8/h1-6,22H,7H2,(H,19,21) |
| InChIKey | HTWRTRRWKUVJCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|