About 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine
4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine (PubChem CID 110457422) has the molecular formula C16H23BrN2O
and a molecular weight of 339.28 g/mol. Its IUPAC name is 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine |
| PubChem CID | 110457422 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine |
| SMILES | CC1Cc2c(Br)cccc2CN1CCN1CCOCC1 |
| InChI | InChI=1S/C16H23BrN2O/c1-13-11-15-14(3-2-4-16(15)17)12-19(13)6-5-18-7-9-20-10-8-18/h2-4,13H,5-12H2,1H3 |
| InChIKey | ROMSEYAJWJWFDC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine?
The IUPAC name of 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine (CID 110457422) is 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine.
What is the SMILES notation for 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine?
The canonical SMILES for 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine is CC1Cc2c(Br)cccc2CN1CCN1CCOCC1.
What is the InChIKey of 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine?
The InChIKey is ROMSEYAJWJWFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrN2O/c1-13-11-15-14(3-2-4-16(15)17)12-19(13)6-5-18-7-9-20-10-8-18/h2-4,13H,5-12H2,1H3.
What are the key properties of 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine?
4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine has a molecular weight of 339.28 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5-bromo-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]morpholine is sourced from PubChem (CID 110457422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).