C19H26N2O3 — CID 110457840
3-[(3,4-dimethylphenyl)methyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione (PubChem CID 110457840) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)methyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(3,4-dimethylphenyl)methyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110457840 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)methyl]-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(CC2CC(=O)N(CCN3CCOCC3)C2=O)cc1C |
| InChI | InChI=1S/C19H26N2O3/c1-14-3-4-16(11-15(14)2)12-17-13-18(22)21(19(17)23)6-5-20-7-9-24-10-8-20/h3-4,11,17H,5-10,12-13H2,1-2H3 |
| InChIKey | QCVZRTALDPNSCW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|