C10H17N3O3 — CID 39220953
(3S)-3-amino-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione (PubChem CID 39220953) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is (3S)-3-amino-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-amino-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 39220953 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (3S)-3-amino-1-(2-morpholin-4-ylethyl)pyrrolidine-2,5-dione |
| SMILES | N[C@H]1CC(=O)N(CCN2CCOCC2)C1=O |
| InChI | InChI=1S/C10H17N3O3/c11-8-7-9(14)13(10(8)15)2-1-12-3-5-16-6-4-12/h8H,1-7,11H2/t8-/m0/s1 |
| InChIKey | XQDMZPSAWICAEE-QMMMGPOBSA-N |
| XLogP | -1.60 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|