C21H36N2O3 — CID 171718752
1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-[(E)-2,4,4,6,6-pentamethylhept-2-enyl]pyrrolidine-2,5-dione (PubChem CID 171718752) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-[(E)-2,4,4,6,6-pentamethylhept-2-enyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-[(E)-2,4,4,6,6-pentamethylhept-2-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 171718752 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-[(E)-2,4,4,6,6-pentamethylhept-2-enyl]pyrrolidine-2,5-dione |
| SMILES | C/C(=C\C(C)(C)CC(C)(C)C)CC1CC(=O)N(CCN2CCOC2)C1=O |
| InChI | InChI=1S/C21H36N2O3/c1-16(13-21(5,6)14-20(2,3)4)11-17-12-18(24)23(19(17)25)8-7-22-9-10-26-15-22/h13,17H,7-12,14-15H2,1-6H3/b16-13+ |
| InChIKey | AJDBBLBUDPMTDX-DTQAZKPQSA-N |
| XLogP | 3.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|