C35H58N4O4 — CID 161103918
1-[5-[4-[2-[2,5-dioxo-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidin-1-yl]ethyl]piperazin-1-yl]pentyl]-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidine-2,5-dione (PubChem CID 161103918) has the molecular formula C35H58N4O4 and a molecular weight of 598.87 g/mol. Its IUPAC name is 1-[5-[4-[2-[2,5-dioxo-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidin-1-yl]ethyl]piperazin-1-yl]pentyl]-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[5-[4-[2-[2,5-dioxo-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidin-1-yl]ethyl]piperazin-1-yl]pentyl]-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 161103918 |
| Molecular Formula | C35H58N4O4 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.45 |
| IUPAC Name | 1-[5-[4-[2-[2,5-dioxo-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidin-1-yl]ethyl]piperazin-1-yl]pentyl]-3-[(E)-2,4,4-trimethylpent-2-enyl]pyrrolidine-2,5-dione |
| SMILES | C/C(=C\C(C)(C)C)CC1CC(=O)N(CCCCCN2CCN(CCN3C(=O)CC(C/C(C)=C/C(C)(C)C)C3=O)CC2)C1=O |
| InChI | InChI=1S/C35H58N4O4/c1-26(24-34(3,4)5)20-28-22-30(40)38(32(28)42)13-11-9-10-12-36-14-16-37(17-15-36)18-19-39-31(41)23-29(33(39)43)21-27(2)25-35(6,7)8/h24-25,28-29H,9-23H2,1-8H3/b26-24+,27-25+ |
| InChIKey | OGVIWTWFGFZEFV-OWUYFMIJSA-N |
| XLogP | 5.29 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|