C19H36N2O2 — CID 90129516
1-[5-(dimethylamino)pentyl]-3-(2,2,3,3-tetramethylbutyl)pyrrolidine-2,5-dione (PubChem CID 90129516) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[5-(dimethylamino)pentyl]-3-(2,2,3,3-tetramethylbutyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[5-(dimethylamino)pentyl]-3-(2,2,3,3-tetramethylbutyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90129516 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-[5-(dimethylamino)pentyl]-3-(2,2,3,3-tetramethylbutyl)pyrrolidine-2,5-dione |
| SMILES | CN(C)CCCCCN1C(=O)CC(CC(C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C19H36N2O2/c1-18(2,3)19(4,5)14-15-13-16(22)21(17(15)23)12-10-8-9-11-20(6)7/h15H,8-14H2,1-7H3 |
| InChIKey | GSAUYQYVIOJPIA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|