C14H26N2O2 — CID 130369576
1-[3-(dimethylamino)propyl]-3-pentan-2-ylpyrrolidine-2,5-dione (PubChem CID 130369576) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-pentan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-pentan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130369576 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-pentan-2-ylpyrrolidine-2,5-dione |
| SMILES | CCCC(C)C1CC(=O)N(CCCN(C)C)C1=O |
| InChI | InChI=1S/C14H26N2O2/c1-5-7-11(2)12-10-13(17)16(14(12)18)9-6-8-15(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | LLGMODGVXPKTSV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|