C40H76N6O4 — CID 176691298
1-[2-[2-[4-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethyl]piperazin-1-yl]ethoxy]ethyl]-3-(3,3,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine-2,5-dione (PubChem CID 176691298) has the molecular formula C40H76N6O4 and a molecular weight of 705.09 g/mol. Its IUPAC name is 1-[2-[2-[4-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethyl]piperazin-1-yl]ethoxy]ethyl]-3-(3,3,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2-[4-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethyl]piperazin-1-yl]ethoxy]ethyl]-3-(3,3,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 176691298 |
| Molecular Formula | C40H76N6O4 |
| Molecular Weight | 705.09 g/mol |
| Exact Mass | 704.59 |
| IUPAC Name | 1-[2-[2-[4-[2-[4-[2-(2-aminoethoxy)ethyl]piperazin-1-yl]ethyl]piperazin-1-yl]ethoxy]ethyl]-3-(3,3,5,5,7,7,8,8-octamethyl-2-methylidenenonyl)pyrrolidine-2,5-dione |
| SMILES | C=C(CC1CC(=O)N(CCOCCN2CCN(CCN3CCN(CCOCCN)CC3)CC2)C1=O)C(C)(C)CC(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H76N6O4/c1-33(39(7,8)31-38(5,6)32-40(9,10)37(2,3)4)29-34-30-35(47)46(36(34)48)24-28-50-27-23-45-20-16-43(17-21-45)13-12-42-14-18-44(19-15-42)22-26-49-25-11-41/h34H,1,11-32,41H2,2-10H3 |
| InChIKey | SDVASCXFTZRJSV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|