C20H38N3O2+ — CID 123304420
2-[2-[2,5-dioxo-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidin-1-yl]ethylamino]ethylazanium (PubChem CID 123304420) has the molecular formula C20H38N3O2+ and a molecular weight of 352.54 g/mol. Its IUPAC name is 2-[2-[2,5-dioxo-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidin-1-yl]ethylamino]ethylazanium.
| Compound Name | 2-[2-[2,5-dioxo-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidin-1-yl]ethylamino]ethylazanium |
|---|---|
| PubChem CID | 123304420 |
| Molecular Formula | C20H38N3O2+ |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 2-[2-[2,5-dioxo-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidin-1-yl]ethylamino]ethylazanium |
| SMILES | C=C(CC1CC(=O)N(CCNCC[NH3+])C1=O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H37N3O2/c1-15(13-20(5,6)14-19(2,3)4)11-16-12-17(24)23(18(16)25)10-9-22-8-7-21/h16,22H,1,7-14,21H2,2-6H3/p+1 |
| InChIKey | HWMDSEOPCAWXKD-UHFFFAOYSA-O |
| XLogP | 1.99 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|