C12H10FNO2 — CID 110458075
(3E)-3-[(3-fluorophenyl)methylidene]-1-methylpyrrolidine-2,5-dione (PubChem CID 110458075) has the molecular formula C12H10FNO2 and a molecular weight of 219.22 g/mol. Its IUPAC name is (3E)-3-[(3-fluorophenyl)methylidene]-1-methylpyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[(3-fluorophenyl)methylidene]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110458075 |
| Molecular Formula | C12H10FNO2 |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (3E)-3-[(3-fluorophenyl)methylidene]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C/C(=C\c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C12H10FNO2/c1-14-11(15)7-9(12(14)16)5-8-3-2-4-10(13)6-8/h2-6H,7H2,1H3/b9-5+ |
| InChIKey | HFRDKEGHZUTOPZ-WEVVVXLNSA-N |
| XLogP | 1.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|