C13H12ClNO4 — CID 110458252
2-[3-[(2-chlorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]acetic acid (PubChem CID 110458252) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 110458252 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-2,5-dioxopyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)CC(Cc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C13H12ClNO4/c14-10-4-2-1-3-8(10)5-9-6-11(16)15(13(9)19)7-12(17)18/h1-4,9H,5-7H2,(H,17,18) |
| InChIKey | CSOSHCQXMKQZBI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|