C8H13N3O — CID 110459897
2-ethyl-N,N-dimethylimidazole-1-carboxamide (PubChem CID 110459897) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-ethyl-N,N-dimethylimidazole-1-carboxamide.
| Compound Name | 2-ethyl-N,N-dimethylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 110459897 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-ethyl-N,N-dimethylimidazole-1-carboxamide |
| SMILES | CCc1nccn1C(=O)N(C)C |
| InChI | InChI=1S/C8H13N3O/c1-4-7-9-5-6-11(7)8(12)10(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | GZCXGWIGORMZFB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |