C13H16N4O — CID 170945897
3,3-bis(2-ethylimidazol-1-yl)prop-2-enal (PubChem CID 170945897) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3,3-bis(2-ethylimidazol-1-yl)prop-2-enal.
| Compound Name | 3,3-bis(2-ethylimidazol-1-yl)prop-2-enal |
|---|---|
| PubChem CID | 170945897 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3,3-bis(2-ethylimidazol-1-yl)prop-2-enal |
| SMILES | CCc1nccn1C(=CC=O)n1ccnc1CC |
| InChI | InChI=1S/C13H16N4O/c1-3-11-14-6-8-16(11)13(5-10-18)17-9-7-15-12(17)4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | PUEDNTDIOZTSOQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|