C22H17NO3 — CID 11046152
(2-oxo-1,3-diphenylindol-3-yl) acetate (PubChem CID 11046152) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2-oxo-1,3-diphenylindol-3-yl) acetate.
| Compound Name | (2-oxo-1,3-diphenylindol-3-yl) acetate |
|---|---|
| PubChem CID | 11046152 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (2-oxo-1,3-diphenylindol-3-yl) acetate |
| SMILES | CC(=O)OC1(c2ccccc2)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H17NO3/c1-16(24)26-22(17-10-4-2-5-11-17)19-14-8-9-15-20(19)23(21(22)25)18-12-6-3-7-13-18/h2-15H,1H3 |
| InChIKey | BYNJFHYTAWJZKV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |