C21H21NO4 — CID 11046368
methyl (E,2R)-2-acetamido-2-benzoyl-5-phenylpent-4-enoate (PubChem CID 11046368) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (E,2R)-2-acetamido-2-benzoyl-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2R)-2-acetamido-2-benzoyl-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 11046368 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl (E,2R)-2-acetamido-2-benzoyl-5-phenylpent-4-enoate |
| SMILES | COC(=O)[C@](C/C=C/c1ccccc1)(NC(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4/c1-16(23)22-21(20(25)26-2,19(24)18-13-7-4-8-14-18)15-9-12-17-10-5-3-6-11-17/h3-14H,15H2,1-2H3,(H,22,23)/b12-9+/t21-/m1/s1 |
| InChIKey | GVVCDEQACWCGSU-VZOQVYJPSA-N |
| XLogP | 3.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|