C16H17N3O — CID 110464293
N,N-bis(prop-2-enyl)-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 110464293) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | N,N-bis(prop-2-enyl)-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 110464293 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N,N-bis(prop-2-enyl)-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C16H17N3O/c1-3-9-19(10-4-2)16(20)14-7-5-13(6-8-14)15-11-17-18-12-15/h3-8,11-12H,1-2,9-10H2,(H,17,18) |
| InChIKey | IIDWRXRLIOGFSI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|