C13H15N3O2 — CID 47460235
5-N,5-N-bis(prop-2-enyl)pyridine-2,5-dicarboxamide (PubChem CID 47460235) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-N,5-N-bis(prop-2-enyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N,5-N-bis(prop-2-enyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 47460235 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-N,5-N-bis(prop-2-enyl)pyridine-2,5-dicarboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(C(N)=O)nc1 |
| InChI | InChI=1S/C13H15N3O2/c1-3-7-16(8-4-2)13(18)10-5-6-11(12(14)17)15-9-10/h3-6,9H,1-2,7-8H2,(H2,14,17) |
| InChIKey | MMTYCMLFEJWEJE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|