C15H15N3O2 — CID 47460377
5-N-benzyl-5-N-methylpyridine-2,5-dicarboxamide (PubChem CID 47460377) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-N-benzyl-5-N-methylpyridine-2,5-dicarboxamide.
| Compound Name | 5-N-benzyl-5-N-methylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 47460377 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-N-benzyl-5-N-methylpyridine-2,5-dicarboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc(C(N)=O)nc1 |
| InChI | InChI=1S/C15H15N3O2/c1-18(10-11-5-3-2-4-6-11)15(20)12-7-8-13(14(16)19)17-9-12/h2-9H,10H2,1H3,(H2,16,19) |
| InChIKey | MIWGKMPNQDYUJP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |