C15H16N4O2 — CID 81310441
5-amino-N-[(4-carbamoylphenyl)methyl]-N-methylpyridine-2-carboxamide (PubChem CID 81310441) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-amino-N-[(4-carbamoylphenyl)methyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-amino-N-[(4-carbamoylphenyl)methyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 81310441 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-amino-N-[(4-carbamoylphenyl)methyl]-N-methylpyridine-2-carboxamide |
| SMILES | CN(Cc1ccc(C(N)=O)cc1)C(=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C15H16N4O2/c1-19(15(21)13-7-6-12(16)8-18-13)9-10-2-4-11(5-3-10)14(17)20/h2-8H,9,16H2,1H3,(H2,17,20) |
| InChIKey | XLYPTBYZULFSBS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |