C15H16FN3O — CID 110464458
1,4-diazepan-1-yl-(6-fluoroquinolin-2-yl)methanone (PubChem CID 110464458) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-(6-fluoroquinolin-2-yl)methanone.
| Compound Name | 1,4-diazepan-1-yl-(6-fluoroquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 110464458 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1,4-diazepan-1-yl-(6-fluoroquinolin-2-yl)methanone |
| SMILES | O=C(c1ccc2cc(F)ccc2n1)N1CCCNCC1 |
| InChI | InChI=1S/C15H16FN3O/c16-12-3-5-13-11(10-12)2-4-14(18-13)15(20)19-8-1-6-17-7-9-19/h2-5,10,17H,1,6-9H2 |
| InChIKey | OOCSHKHXXZEQFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |