C19H16F3N5O2 — CID 118273611
piperazin-1-yl-[6-[6-(trifluoromethyl)pyridazin-3-yl]oxyquinolin-2-yl]methanone (PubChem CID 118273611) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is piperazin-1-yl-[6-[6-(trifluoromethyl)pyridazin-3-yl]oxyquinolin-2-yl]methanone.
| Compound Name | piperazin-1-yl-[6-[6-(trifluoromethyl)pyridazin-3-yl]oxyquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 118273611 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | piperazin-1-yl-[6-[6-(trifluoromethyl)pyridazin-3-yl]oxyquinolin-2-yl]methanone |
| SMILES | O=C(c1ccc2cc(Oc3ccc(C(F)(F)F)nn3)ccc2n1)N1CCNCC1 |
| InChI | InChI=1S/C19H16F3N5O2/c20-19(21,22)16-5-6-17(26-25-16)29-13-2-4-14-12(11-13)1-3-15(24-14)18(28)27-9-7-23-8-10-27/h1-6,11,23H,7-10H2 |
| InChIKey | IVDZDNBTEATXQK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |