C19H36O4Si — CID 11046515
tert-butyl (1S,2S,3S)-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-2-ethoxy-3-methylcyclopropane-1-carboxylate (PubChem CID 11046515) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl (1S,2S,3S)-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-2-ethoxy-3-methylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl (1S,2S,3S)-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-2-ethoxy-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11046515 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tert-butyl (1S,2S,3S)-1-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-2-ethoxy-3-methylcyclopropane-1-carboxylate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)[C@]1(C(=O)OC(C)(C)C)[C@H](C)[C@@H]1OCC |
| InChI | InChI=1S/C19H36O4Si/c1-12-21-15-13(2)19(15,16(20)22-17(4,5)6)14(3)23-24(10,11)18(7,8)9/h13,15H,3,12H2,1-2,4-11H3/t13-,15+,19-/m1/s1 |
| InChIKey | XITUQKAFABZPRZ-FRIZHTMISA-N |
| XLogP | 4.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|