C15H27BrO3Si — CID 11046690
(4R,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one (PubChem CID 11046690) has the molecular formula C15H27BrO3Si and a molecular weight of 363.37 g/mol. Its IUPAC name is (4R,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one.
| Compound Name | (4R,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11046690 |
| Molecular Formula | C15H27BrO3Si |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (4R,5S)-2-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)O[C@@H]1C=C(Br)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27BrO3Si/c1-14(2,3)18-11-9-10(16)12(17)13(11)19-20(7,8)15(4,5)6/h9,11,13H,1-8H3/t11-,13+/m1/s1 |
| InChIKey | HFGVEFSVOWOEPV-YPMHNXCESA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|