C16H17FN2O — CID 110467073
N-[1-(4-fluorophenyl)cyclobutyl]-1-methylpyrrole-2-carboxamide (PubChem CID 110467073) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)cyclobutyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)cyclobutyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 110467073 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)cyclobutyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C16H17FN2O/c1-19-11-2-4-14(19)15(20)18-16(9-3-10-16)12-5-7-13(17)8-6-12/h2,4-8,11H,3,9-10H2,1H3,(H,18,20) |
| InChIKey | AGOILHAPXRATIY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |