C22H18F2OSi — CID 11046730
1,1-difluorobuta-1,3-dien-2-yloxy(triphenyl)silane (PubChem CID 11046730) has the molecular formula C22H18F2OSi and a molecular weight of 364.47 g/mol. Its IUPAC name is 1,1-difluorobuta-1,3-dien-2-yloxy(triphenyl)silane.
| Compound Name | 1,1-difluorobuta-1,3-dien-2-yloxy(triphenyl)silane |
|---|---|
| PubChem CID | 11046730 |
| Molecular Formula | C22H18F2OSi |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1,1-difluorobuta-1,3-dien-2-yloxy(triphenyl)silane |
| SMILES | C=CC(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)=C(F)F |
| InChI | InChI=1S/C22H18F2OSi/c1-2-21(22(23)24)25-26(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h2-17H,1H2 |
| InChIKey | IZZYKVVDNXZBNO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|