C11H11F6O3PS — CID 11046828
bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfanylbenzene (PubChem CID 11046828) has the molecular formula C11H11F6O3PS and a molecular weight of 368.24 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfanylbenzene.
| Compound Name | bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfanylbenzene |
|---|---|
| PubChem CID | 11046828 |
| Molecular Formula | C11H11F6O3PS |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfanylbenzene |
| SMILES | O=P(CSc1ccccc1)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C11H11F6O3PS/c12-10(13,14)6-19-21(18,20-7-11(15,16)17)8-22-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | YRRPXEDTECWQGT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|