C11H11F6O4PS — CID 10905096
bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfinylbenzene (PubChem CID 10905096) has the molecular formula C11H11F6O4PS and a molecular weight of 384.23 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfinylbenzene.
| Compound Name | bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfinylbenzene |
|---|---|
| PubChem CID | 10905096 |
| Molecular Formula | C11H11F6O4PS |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | bis(2,2,2-trifluoroethoxy)phosphorylmethylsulfinylbenzene |
| SMILES | O=S(CP(=O)(OCC(F)(F)F)OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H11F6O4PS/c12-10(13,14)6-20-22(18,21-7-11(15,16)17)8-23(19)9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | MZORVWLOKORJON-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|