C15H24FO5PS — CID 101149171
(1-diethoxyphosphoryl-1-fluoro-3-methylbutyl)sulfonylbenzene (PubChem CID 101149171) has the molecular formula C15H24FO5PS and a molecular weight of 366.39 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-1-fluoro-3-methylbutyl)sulfonylbenzene.
| Compound Name | (1-diethoxyphosphoryl-1-fluoro-3-methylbutyl)sulfonylbenzene |
|---|---|
| PubChem CID | 101149171 |
| Molecular Formula | C15H24FO5PS |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (1-diethoxyphosphoryl-1-fluoro-3-methylbutyl)sulfonylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(CC(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24FO5PS/c1-5-20-22(17,21-6-2)15(16,12-13(3)4)23(18,19)14-10-8-7-9-11-14/h7-11,13H,5-6,12H2,1-4H3 |
| InChIKey | QNJOQAIIXPWACS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|