C21H34FO5PS — CID 134905256
(1-diethoxyphosphoryl-1-fluoro-4,8-dimethylnon-7-enyl)sulfonylbenzene (PubChem CID 134905256) has the molecular formula C21H34FO5PS and a molecular weight of 448.54 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-1-fluoro-4,8-dimethylnon-7-enyl)sulfonylbenzene.
| Compound Name | (1-diethoxyphosphoryl-1-fluoro-4,8-dimethylnon-7-enyl)sulfonylbenzene |
|---|---|
| PubChem CID | 134905256 |
| Molecular Formula | C21H34FO5PS |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (1-diethoxyphosphoryl-1-fluoro-4,8-dimethylnon-7-enyl)sulfonylbenzene |
| SMILES | CCOP(=O)(OCC)C(F)(CCC(C)CCC=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H34FO5PS/c1-6-26-28(23,27-7-2)21(22,17-16-19(5)13-11-12-18(3)4)29(24,25)20-14-9-8-10-15-20/h8-10,12,14-15,19H,6-7,11,13,16-17H2,1-5H3 |
| InChIKey | WBFURWKVIFBZJH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|