C17H20FO3PS — CID 101266506
(diethoxyphosphoryl-fluoro-phenylsulfanylmethyl)benzene (PubChem CID 101266506) has the molecular formula C17H20FO3PS and a molecular weight of 354.38 g/mol. Its IUPAC name is (diethoxyphosphoryl-fluoro-phenylsulfanylmethyl)benzene.
| Compound Name | (diethoxyphosphoryl-fluoro-phenylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 101266506 |
| Molecular Formula | C17H20FO3PS |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (diethoxyphosphoryl-fluoro-phenylsulfanylmethyl)benzene |
| SMILES | CCOP(=O)(OCC)C(F)(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20FO3PS/c1-3-20-22(19,21-4-2)17(18,15-11-7-5-8-12-15)23-16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | JXFXDINXKJYWDQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|