C19H20ClF2O3PS — CID 139189673
[(E)-2-chloro-1-[diethoxyphosphoryl(difluoro)methyl]sulfanyl-2-phenylethenyl]benzene (PubChem CID 139189673) has the molecular formula C19H20ClF2O3PS and a molecular weight of 432.86 g/mol. Its IUPAC name is [(E)-2-chloro-1-[diethoxyphosphoryl(difluoro)methyl]sulfanyl-2-phenylethenyl]benzene.
| Compound Name | [(E)-2-chloro-1-[diethoxyphosphoryl(difluoro)methyl]sulfanyl-2-phenylethenyl]benzene |
|---|---|
| PubChem CID | 139189673 |
| Molecular Formula | C19H20ClF2O3PS |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | [(E)-2-chloro-1-[diethoxyphosphoryl(difluoro)methyl]sulfanyl-2-phenylethenyl]benzene |
| SMILES | CCOP(=O)(OCC)C(F)(F)S/C(=C(/Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20ClF2O3PS/c1-3-24-26(23,25-4-2)19(21,22)27-18(16-13-9-6-10-14-16)17(20)15-11-7-5-8-12-15/h5-14H,3-4H2,1-2H3/b18-17+ |
| InChIKey | PFNLWZDCZOAOQH-ISLYRVAYSA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|